4-Chloro-2-iodo-6-nitro-phenylamine structure
|
Common Name | 4-Chloro-2-iodo-6-nitro-phenylamine | ||
|---|---|---|---|---|
| CAS Number | 123158-75-8 | Molecular Weight | 298.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4ClIN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-2-iodo-6-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4ClIN2O2 |
|---|---|
| Molecular Weight | 298.46600 |
| Exact Mass | 297.90100 |
| PSA | 71.84000 |
| LogP | 3.53940 |
| InChIKey | WDQPNLNIJFQQRL-UHFFFAOYSA-N |
| SMILES | Nc1c(I)cc(Cl)cc1[N+](=O)[O-] |
|
~72%
4-Chloro-2-iodo... CAS#:123158-75-8 |
| Literature: Dohle, Wolfgang; Staubitz, Anne; Knochel, Paul Chemistry - A European Journal, 2003 , vol. 9, # 21 p. 5323 - 5331 |
|
~%
4-Chloro-2-iodo... CAS#:123158-75-8 |
| Literature: Bradfield; Orton; Roberts Journal of the Chemical Society, 1928 , p. 783 |
|
~%
4-Chloro-2-iodo... CAS#:123158-75-8 |
| Literature: Bradfield; Orton; Roberts Journal of the Chemical Society, 1928 , p. 783 |
| 4-chloro-2-iodo-6-nitro-aniline |
| 4-Chlor-2-jod-6-nitro-anilin |
| 2-iodo-4-chloro-6-nitro-phenylamine |
| 2-amino-5-chloro-3-nitrophenyliodide |