N-(4-chloro-2-phenyl-phenyl)benzamide structure
|
Common Name | N-(4-chloro-2-phenyl-phenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 5472-25-3 | Molecular Weight | 307.77400 | |
| Density | 1.346g/cm3 | Boiling Point | 438.3ºC at 760 mmHg | |
| Molecular Formula | C19H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
| Name | N-(5-chloro-9,10-dioxo-9,10-dihydro-[1]anthryl)-toluene-4-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 438.3ºC at 760 mmHg |
| Molecular Formula | C19H14ClNO |
| Molecular Weight | 307.77400 |
| Flash Point | 218.9ºC |
| Exact Mass | 307.07600 |
| PSA | 29.10000 |
| LogP | 5.33230 |
| Index of Refraction | 1.667 |
| InChIKey | FCQRBRJBQDHPAG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1-c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-chloro-2-p... CAS#:5472-25-3 |
| Literature: Smith et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 524,526 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chlor-2-benzamino-diphenyl |
| N-(5-chloro-biphenyl-2-yl)-benzamide |
| N-(5-Chloro-9,10-dihydro-9,10-dioxo-1-anthryl)-p-toluenesulphonamide |
| 5-Chlor-1-(toluol-sulfonyl-(4)-amino)-anthrachinon |
| N-(5-Chlor-biphenyl-2-yl)-benzamid |
| N-(5-Chlor-9,10-dioxo-9,10-dihydro-[1]anthryl)-toluol-4-sulfonamid |
| N-(5-chloro-9,10-dihydro-9,10-dioxo-1-anthryl)-p-toluenesulfonamide |