1-chloro-3-methoxy-2-nitro-benzene structure
|
Common Name | 1-chloro-3-methoxy-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5472-99-1 | Molecular Weight | 187.58000 | |
| Density | 1.366g/cm3 | Boiling Point | 292.2ºC at 760mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.5ºC | |
| Name | 1-Chloro-3-methoxy-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 292.2ºC at 760mmHg |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58000 |
| Flash Point | 130.5ºC |
| Exact Mass | 187.00400 |
| PSA | 55.05000 |
| LogP | 2.78000 |
| Index of Refraction | 1.559 |
| InChIKey | JFDFFRYBIFYDKP-UHFFFAOYSA-N |
| SMILES | COc1cccc(Cl)c1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-chloro-3-methoxy-2-nitro-benzene |
| 3-chloro-2-nitroanisole |
| 3-Chlor-2-nitro-anisol |