Benzenamine,4-methoxy-2,3-dinitro- structure
|
Common Name | Benzenamine,4-methoxy-2,3-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 5473-00-7 | Molecular Weight | 213.14800 | |
| Density | 1.529g/cm3 | Boiling Point | 465.6ºC at 760mmHg | |
| Molecular Formula | C7H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | 1-(pyridin-2-ylmethyl)-2,3-dihydroindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 465.6ºC at 760mmHg |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.14800 |
| Flash Point | 235.4ºC |
| Exact Mass | 213.03900 |
| PSA | 126.89000 |
| LogP | 2.72140 |
| Index of Refraction | 1.64 |
| InChIKey | KKIFNGUMEDQAHY-UHFFFAOYSA-N |
| SMILES | COc1ccc(N)c([N+](=O)[O-])c1[N+](=O)[O-] |
| HS Code | 2922299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-methoxy-2,3-dinitro-aniline |
| 2.3-Dinitro-4-amino-anisol |
| 2.3-Dimethylnaphtho<1.2-b>thiophen-5-carbonitril |
| 2,3-dinitro-4-methoxyaniline |
| 2.3-Dinitro-4-amino-phenol-methylaether |
| 2.3-Dinitro-p-anisidin |