clovoxamine structure
|
Common Name | clovoxamine | ||
|---|---|---|---|---|
| CAS Number | 54739-21-8 | Molecular Weight | 400.85400 | |
| Density | N/A | Boiling Point | 387.8ºC at 760 mmHg | |
| Molecular Formula | C18H25ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.3ºC | |
| Name | (E)-but-2-enedioic acid,2-[(E)-[1-(4-chlorophenyl)-5-methoxypentylidene]amino]oxyethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 387.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H25ClN2O6 |
| Molecular Weight | 400.85400 |
| Flash Point | 188.3ºC |
| Exact Mass | 400.14000 |
| PSA | 131.44000 |
| LogP | 3.24820 |
| InChIKey | HOFGGHPYWKSXTN-QCHLHFLZSA-N |
| SMILES | COCCCCC(=NOCCN)c1ccc(Cl)cc1.O=C(O)C=CC(=O)O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Clovoxamine |
| 4'-Chloro-5-methoxyvalerophenone (E)-O-(2-aminoethyl)oxime fumarate |
| 1-Pentanone,1-(4-chlorophenyl)-5-methoxy-,O-(2-aminoethyl)oxime,(1E)-,(2E)-2-butenedioate (1:1) |
| (E)-1-(4-Chlorophenyl)-5-methoxy-1-pentanone O-(2-aminoethyl)oxime,(E)-2-butenedioate (1:1) |
| Clovoxamine fumarate |