1,2-vinylenebis(triphenylphosphonium bromide) structure
|
Common Name | 1,2-vinylenebis(triphenylphosphonium bromide) | ||
|---|---|---|---|---|
| CAS Number | 54770-27-3 | Molecular Weight | 710.41600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H32Br2P2 | Melting Point | 230-234ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-vinylenebis(triphenylphosphonium bromide) |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 230-234ºC |
|---|---|
| Molecular Formula | C38H32Br2P2 |
| Molecular Weight | 710.41600 |
| Exact Mass | 708.03500 |
| PSA | 27.18000 |
| LogP | 1.45380 |
| InChIKey | TVFYBHGFLHYJNV-GLDAUVFXSA-L |
| SMILES | C(=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].[Br-] |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonium,1,2-ethenediylbistriphenyl-,dibromide |