WAY-321873
Modify Date: 2025-08-26 14:12:30
WAY-321873 structure
|
Common Name | WAY-321873 | ||
|---|---|---|---|---|
| CAS Number | 547704-53-0 | Molecular Weight | 435.45578 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H17N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-321873modulator of GATA4-NKX2-5 transcriptional synergy ; AKT inhibitor; pleckstrin homology domain inhibitors; Inhibitor of the Pleckstrin Homology Domain of Protein Kinase B/AKT; |
| Name | WAY-321873 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H17N5O4S |
| Molecular Weight | 435.45578 |
| Exact Mass | 435.100128 |
| LogP | 1.57 |
| Index of Refraction | 1.667 |
| InChIKey | NXEGZWIILLRUAX-UHFFFAOYSA-N |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| 4-Isoxazolecarboxamide, 5-methyl-3-phenyl-N-[4-[(2-pyrimidinylamino)sulfonyl]phenyl]- |
| 5-Methyl-3-phenyl-N-[4-(2-pyrimidinylsulfamoyl)phenyl]-1,2-oxazole-4-carboxamide |
| MFCD03397735 |