zinc,2-methanidyl-2-methylpropane structure
|
Common Name | zinc,2-methanidyl-2-methylpropane | ||
|---|---|---|---|---|
| CAS Number | 54773-23-8 | Molecular Weight | 207.66200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | zinc,2-methanidyl-2-methylpropane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22Zn |
|---|---|
| Molecular Weight | 207.66200 |
| Exact Mass | 206.10100 |
| LogP | 3.73070 |
| InChIKey | ONYPPVBKLADTTK-UHFFFAOYSA-N |
| SMILES | [CH2-]C(C)(C)C.[CH2-]C(C)(C)C.[Zn+2] |
|
~%
zinc,2-methanid... CAS#:54773-23-8 |
| Literature: Gal, Anton W.; Heijden, Harry van der Journal of the Chemical Society, Chemical Communications, 1983 , # 8 p. 420 - 422 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| bis(2,2-dimethylpropyl) zinc |
| Zn(neopentyl)2 |
| dineopenylzinc |
| dineopentylzinc |
| Zinc,bis(2,2-dimethylpropyl) |
| Dineopentyl-zink |