trimethyl-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)oxysilane structure
|
Common Name | trimethyl-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)oxysilane | ||
|---|---|---|---|---|
| CAS Number | 54781-28-1 | Molecular Weight | 210.38800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)oxysilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22OSi |
|---|---|
| Molecular Weight | 210.38800 |
| Exact Mass | 210.14400 |
| PSA | 9.23000 |
| LogP | 4.09800 |
| InChIKey | RNSJHLAKLJKNSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(O[Si](C)(C)C)=CC(C)(C)C1 |
|
~%
trimethyl-(3,3,... CAS#:54781-28-1
Detail
|
| Literature: Krafft, Marie E.; Holton, Robert A. Journal of the American Chemical Society, 1984 , vol. 106, p. 7619 - 7621 |
|
~%
trimethyl-(3,3,... CAS#:54781-28-1 |
| Literature: Blanco,L. et al. Synthesis, 1976 , p. 194 - 196 |
|
~%
trimethyl-(3,3,... CAS#:54781-28-1 |
| Literature: Emde, Herbert; Goetz, Andreas; Hofmann, Karin; Simchen, Gerhard Liebigs Annalen der Chemie, 1981 , # 9 p. 1643 - 1657 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| 1,5,5-Trimethyl-3-(trimethylsiloxy)-1,3-cyclohexadien |
| 4,6,6-trimethylcyclohexa-1,3-dien-2-ol trimethylsilyl ether |
| 2-Trimethylsilyloxy-4,6,6-trimethylcyclohexa-1,3-dien |
| 2-Siloxi-4.6.6-trimethyl-cyclohexadien(1.3) |
| Silane,trimethyl[(3,3,5-trimethyl-1,5-cyclohexadien-1-yl)oxy] |
| 4,6,6-trimethyl-2-trimethylsilyloxycyclohexa-1,3-diene |