Trimethylsilyl trifluoromethanesulfonate structure
|
Common Name | Trimethylsilyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 27607-77-8 | Molecular Weight | 222.258 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 140.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C4H9F3O3SSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 38.5±25.9 °C | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | Trimethylsilyl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 140.0±35.0 °C at 760 mmHg |
| Molecular Formula | C4H9F3O3SSi |
| Molecular Weight | 222.258 |
| Flash Point | 38.5±25.9 °C |
| Exact Mass | 221.999374 |
| PSA | 51.75000 |
| LogP | 2.54 |
| Vapour Pressure | 7.8±0.2 mmHg at 25°C |
| Index of Refraction | 1.379 |
| InChIKey | FTVLMFQEYACZNP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Storage condition | 2-8°C |
| Water Solubility | REACTS |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive |
| Risk Phrases | R10;R14;R34 |
| Safety Phrases | S16-S26-S36/37/39-S45-S8 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 29310095 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Trimethylsilyl trifluoromethanesulfonate-promoted reductive 2'-O-arylmethylation of ribonucleoside derivatives.
Nucleosides Nucleotides Nucleic Acids 30(6) , 446-56, (2011) Arylmethyl groups such as benzyl, p-methoxybenzyl, and 1-pyrenylmethyl groups were introduced to the 2'-O-position of nucleosides by reductive etherification. Combining corresponding aromatic aldehyde... |
|
|
Trimethylsilyl trifluoromethanesulfonate (TMSOTf) assisted facile deprotection of N,O-acetonides.
J. Org. Chem. 73(2) , 752-5, (2008) Employing TMSOTf as an easily available reagent, we have developed a mild and efficient method for the deprotection of both terminal and internal N,0-acetonide functionalities. Various regularly used ... |
|
|
Nucleophilic substitution at the anomeric position of 1,2-O-isopropylidenefuranose derivatives. A novel stereoselective synthesis of cyclic phosphates analogous to cAMP.
Carbohydr. Res. 341(18) , 2883-90, (2006) 1,2-O-Isopropylidenefuranose derivatives were treated with various nucleophiles in the presence of either BF(3).OEt(2) or trimethylsilyl trifluoromethanesulfonate (TMSOTf) leading to substitution prod... |
| MFCD00000406 |
| Trifluoromethanesulfonic acid trimethylsilylester |
| Trimethylsilyl Trifluoromethanesulfonate [Trimethylsilylating Agent] |
| Methanesulfonic acid, trifluoro-, trimethylsilyl ester |
| Methanesulfonic acid, 1,1,1-trifluoro-, trimethylsilyl ester |
| trifluoromethanesulfonic acid trimethylsilyl ester |
| Trimethylsilyl Triflate |
| [(Trifluoromethane-sulfonyl)oxy]trimethylsilane |
| trimethylsilyl trifluoromethane-sulphonate |
| trifluoromethanesulphonic acid trimethylsilyl ester |
| EINECS 248-565-4 |
| Silane TMS-triflate |
| Trimethylsllytrifluoromethanesulphonate |
| Trimethylsilyl trifluoromethanesulfonate |
| TMS-OTf |
| TMS triflate |
| Trimethylsilyl trifluoromethylsulfonate |
| TMSOTf |
| trimethylsilyl trifluoromethylsulphonate |