Ethyl Biscoumacetate structure
|
Common Name | Ethyl Biscoumacetate | ||
|---|---|---|---|---|
| CAS Number | 548-00-5 | Molecular Weight | 408.35800 | |
| Density | 1.3259 (rough estimate) | Boiling Point | 448.92°C (rough estimate) | |
| Molecular Formula | C22H16O8 | Melting Point | 177-182° and mp 154-157° | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2,2-bis(4-hydroxy-2-oxochromen-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3259 (rough estimate) |
|---|---|
| Boiling Point | 448.92°C (rough estimate) |
| Melting Point | 177-182° and mp 154-157° |
| Molecular Formula | C22H16O8 |
| Molecular Weight | 408.35800 |
| Exact Mass | 408.08500 |
| PSA | 127.18000 |
| LogP | 3.00560 |
| Index of Refraction | 1.4480 (estimate) |
| InChIKey | JCLHQFUTFHUXNN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(c1c(O)c2ccccc2oc1=O)c1c(O)c2ccccc2oc1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| RIDADR | UN 2811 |
|---|---|
| Packaging Group | III |
| HS Code | 2932209090 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with human liver microsomes
Source: 824
Target: tumor suppressor p53 [Homo sapiens]
External Id: P53MS233
|
| Neodicoumarin |
| Trombil |
| Trombolysan |
| Ethylbiscum-acetat |
| Tromexan |
| Neodicumarinum |
| Bisoxycumarin-essigsaeureethylester |
| Pelentan |
| Neodicoumarol |
| Trombarin |
| Neodicumarol |
| ETHYL BISCOUMACETATE |
| Ethylbiscoumacetat |