2,5-Dihydroxy-3,6-diphenyl-p-benzoquinone structure
|
Common Name | 2,5-Dihydroxy-3,6-diphenyl-p-benzoquinone | ||
|---|---|---|---|---|
| CAS Number | 548-59-4 | Molecular Weight | 292.28500 | |
| Density | 1.458g/cm3 | Boiling Point | 535.5ºC at 760 mmHg | |
| Molecular Formula | C18H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.7ºC | |
| Name | 2,5-dihydroxy-3,6-diphenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 535.5ºC at 760 mmHg |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.28500 |
| Flash Point | 291.7ºC |
| Exact Mass | 292.07400 |
| PSA | 74.60000 |
| LogP | 3.07680 |
| Index of Refraction | 1.72 |
| InChIKey | HZKFHDXTSAYOSN-UHFFFAOYSA-N |
| SMILES | O=C1C(O)=C(c2ccccc2)C(=O)C(O)=C1c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2914400090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: Antiproliferative activity against human HL-60 cells assessed as inhibition of cell g...
Source: ChEMBL
Target: HL-60
External Id: CHEMBL5216754
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Inhibition of His-tagged human src kinase expressed in Sf9 cells at 35 umol/l by DELF...
Source: ChEMBL
Target: Proto-oncogene tyrosine-protein kinase Src
External Id: CHEMBL974770
|
| Polyporin |
| 2,5-Dihydroxy-3,6-diphenyl-[1,4]benzochinon |
| 2,5-dihydroxy-3,6-diphenylbenzoquinone |
| Orygameic acid |
| polyporic acid |
| 2,5-Dihydroxy-3,6-diphenyl-p-benzoquinone |
| 2,5-dihydroxy-3,6-diphenyl-2,5-cyclohexadiene-1,4-dione |
| S 1148 |
| 2,5-dihydroxy-3,6-diphenyl-1,4-benzoquinone |
| p-BENZOQUINONE,2,5-DIHYDROXY-3,6-DIPHENYL |