chromotrope 2b structure
|
Common Name | chromotrope 2b | ||
|---|---|---|---|---|
| CAS Number | 548-80-1 | Molecular Weight | 513.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9N3Na2O10S2 | Melting Point | 300 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | disodium,(3E)-5-hydroxy-3-[(4-nitrophenyl)hydrazinylidene]-4-oxonaphthalene-2,7-disulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 300 °C |
|---|---|
| Molecular Formula | C16H9N3Na2O10S2 |
| Molecular Weight | 513.36600 |
| Exact Mass | 512.95200 |
| PSA | 242.16000 |
| LogP | 5.06760 |
| InChIKey | AXUUHWJXDWBCSG-UHFFFAOYSA-L |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])cc(O)c3c2O)cc1.[Na+].[Na+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2927000090 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Spectrophotometric assay of cephalosporins in pharmaceutical products, using chromotrope 2B and chromotrope 2R. Issa YM and Amin AS
Microchim. Acta 124 (3-4) , 203-209, (1996)
|
|
|
On-line preconcentration of aluminium with immobilized Chromotrope 2B for the determination by flame atomic absorption spectrometry and inductively coupled plasma mass spectrometry. Martin-esteban A, et.al.
Anal. Chim. Acta 304 (1) , 121-126, (1995)
|
| Chromatrope 2B |
| EINECS 208-959-9 |
| Chromotrope Red 4B |
| p-Nitrobenzeneazochromotropic acid sodium salt |
| Chromotrope 2B disodium salt |
| chromotrope 2B |
| MFCD00003951 |
| Naphtocard Fast Red 3B |
| Khromotrop 2B |
| Acid Red 176 |