Pinobanksin structure
|
Common Name | Pinobanksin | ||
|---|---|---|---|---|
| CAS Number | 548-82-3 | Molecular Weight | 272.25 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 570.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.0±23.6 °C | |
Use of PinobanksinPinobanksin has apoptotic induction in a B-cell lymphoma cell line[1]. |
| Name | pinobanksin |
|---|---|
| Synonym | More Synonyms |
| Description | Pinobanksin has apoptotic induction in a B-cell lymphoma cell line[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 570.6±50.0 °C at 760 mmHg |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 |
| Flash Point | 222.0±23.6 °C |
| Exact Mass | 272.068481 |
| PSA | 86.99000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | SUYJZKRQHBQNCA-LSDHHAIUSA-N |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccccc2)C1O |
| Hazard Codes | Xi |
|---|
| (2R,3R)-3,5,7-Trihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Pinobanksin |
| (2R,3R)-3,5,7-trihydroxy-2-phenyl-2,3-dihydrochromen-4-one |