Oxysophoridine structure
|
Common Name | Oxysophoridine | ||
|---|---|---|---|---|
| CAS Number | 54809-74-4 | Molecular Weight | 264.363 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OxysophoridineOxysophoridine (Sophoridine N-oxide) is a bioactive alkaloid extracted from the Sophora alopecuroides Linn. Oxysophoridine (Sophoridine N-oxide) shows anti inflammatory, anti oxidative stress and anti apoptosis effects[1][2]. |
| Name | (+)-matrine N-oxide |
|---|---|
| Synonym | More Synonyms |
| Description | Oxysophoridine (Sophoridine N-oxide) is a bioactive alkaloid extracted from the Sophora alopecuroides Linn. Oxysophoridine (Sophoridine N-oxide) shows anti inflammatory, anti oxidative stress and anti apoptosis effects[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H24N2O2 |
|---|---|
| Molecular Weight | 264.363 |
| Exact Mass | 264.183777 |
| PSA | 49.74000 |
| LogP | -0.35 |
| InChIKey | XVPBINOPNYFXID-GALOSNBCSA-N |
| SMILES | O=C1CCCC2C3CCC[N+]4([O-])CCCC(CN12)C34 |
| Storage condition | 2-8C |
| (41S,7AS,13AR,13BR)-10-OXOHEXADECAHYDRODIPYRIDO[2,1-F:3',2',1'-IJ][1,6]NAPHTHYRIDINE 4-OXIDE |
| Matrine N-oxide |
| (7aS,13aR,13bR,13cS)Dodecahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one 4-oxide |
| Oxysophoridine |
| Oxymatrine |