11a,11b-Dihydro-11H-spiro(furan-3,8-furo(3,4:3,4)pyrrolo(2,1-a)phthalazine)-2,5,9,11(4H,8aH)-tetrone structure
|
Common Name | 11a,11b-Dihydro-11H-spiro(furan-3,8-furo(3,4:3,4)pyrrolo(2,1-a)phthalazine)-2,5,9,11(4H,8aH)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 54864-49-2 | Molecular Weight | 326.26000 | |
| Density | 1.91g/cm3 | Boiling Point | 692.7ºC at 760 mmHg | |
| Molecular Formula | C16H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.7ºC | |
| Name | 2,5-dioxo-(3'rC2,10'bt)-4,5,1',10'b-tetrahydro-2'H-spiro[furan-3,3'-pyrrolo[2,1-a]phthalazine]-1'c,2'c-dicarboxylic acid anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.91g/cm3 |
|---|---|
| Boiling Point | 692.7ºC at 760 mmHg |
| Molecular Formula | C16H10N2O6 |
| Molecular Weight | 326.26000 |
| Flash Point | 372.7ºC |
| Exact Mass | 326.05400 |
| PSA | 102.34000 |
| Index of Refraction | 1.866 |
| InChIKey | RFTAQWRCVVHXEW-UHFFFAOYSA-N |
| SMILES | O=C1CC2(C(=O)O1)C1C(=O)OC(=O)C1C1c3ccccc3C=NN12 |
|
~%
11a,11b-Dihydro... CAS#:54864-49-2 |
| Literature: Hocking,M.B. Journal of Heterocyclic Chemistry, 1977 , vol. 14, p. 829 - 837 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (8'rC2,8'at,11'at,11'bt)-11'a,11'b-dihydro-8'aH-spiro[furan-3,8'-furo[3',4':3,4]pyrrolo[2,1-a]phthalazine]-2,5,9',11'-tetraone |
| 11a',11b'-Dihydro-11'H-spiro[furan-3,8'-furo[3',4':3,4]pyrrolo[2,1-a]phthalazine]-2,5,9',11'(4H,8a'H)-tetrone |