2,5-DIHYDROXY-1,4-BENZENEDIACETIC ACID structure
|
Common Name | 2,5-DIHYDROXY-1,4-BENZENEDIACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 5488-16-4 | Molecular Weight | 226.18300 | |
| Density | 1.602g/cm3 | Boiling Point | 574.5ºC at 760mmHg | |
| Molecular Formula | C10H10O6 | Melting Point | 281-283ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 315.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Dihydroxy-1,4-benzenediacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.602g/cm3 |
|---|---|
| Boiling Point | 574.5ºC at 760mmHg |
| Melting Point | 281-283ºC (dec.)(lit.) |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18300 |
| Flash Point | 315.3ºC |
| Exact Mass | 226.04800 |
| PSA | 115.06000 |
| LogP | 0.35200 |
| InChIKey | MCLKERLHVBEZIW-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(O)c(CC(=O)O)cc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918290000 |
|
~80%
2,5-DIHYDROXY-1... CAS#:5488-16-4 |
| Literature: Connor, Daniel M.; Trzupek, Larry; Lee, Moses; Whitehead, Daniel Patent: US2006/223993 A1, 2006 ; Location in patent: Page/Page column 6 ; |
|
~63%
2,5-DIHYDROXY-1... CAS#:5488-16-4 |
| Literature: Lei, Ting; Dou, Jin-Hu; Cao, Xiao-Yu; Wang, Jie-Yu; Pei, Jian Journal of the American Chemical Society, 2013 , vol. 135, # 33 p. 12168 - 12171 |
|
~%
2,5-DIHYDROXY-1... CAS#:5488-16-4 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 33 p. 12168 - 12171 |
|
~%
2,5-DIHYDROXY-1... CAS#:5488-16-4 |
| Literature: Gazzetta Chimica Italiana, , vol. 80, p. 757,760 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
Name: Inhibition of PTP1B
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL905766
|
| 2-[4-(carboxymethyl)-2,5-dihydroxyphenyl]acetic acid |
| MFCD00004325 |
| EINECS 226-819-5 |