diethyl 2-(2-methyl-3-oxo-butyl)propanedioate structure
|
Common Name | diethyl 2-(2-methyl-3-oxo-butyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5491-06-5 | Molecular Weight | 244.28400 | |
| Density | 1.055g/cm3 | Boiling Point | 323.1ºC at 760 mmHg | |
| Molecular Formula | C12H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.5ºC | |
| Name | diethyl 2-(2-methyl-3-oxobutyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 323.1ºC at 760 mmHg |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.28400 |
| Flash Point | 138.5ºC |
| Exact Mass | 244.13100 |
| PSA | 69.67000 |
| LogP | 1.34400 |
| Index of Refraction | 1.441 |
| InChIKey | YWGCTCBWPLIPQG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(C)C(C)=O)C(=O)OCC |
|
~%
diethyl 2-(2-me... CAS#:5491-06-5 |
| Literature: Horner,J.K. et al. Canadian Journal of Chemistry, 1966 , vol. 44, p. 307 - 313 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Carbethoxy-4-acetyl-valeriansaeure-ethylester |
| 5-Oxo-4-methyl-2-carbethoxy-hexansaeure-ethylester |