3,5-bis[4-(dimethylamino)phenyl]-4-heptanoyl-2-pentylcyclohexan-1-one structure
|
Common Name | 3,5-bis[4-(dimethylamino)phenyl]-4-heptanoyl-2-pentylcyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 54951-60-9 | Molecular Weight | 518.77300 | |
| Density | 1.02g/cm3 | Boiling Point | 654.2ºC at 760mmHg | |
| Molecular Formula | C34H50N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9ºC | |
| Name | 3,5-bis[4-(dimethylamino)phenyl]-4-heptanoyl-2-pentylcyclohexan-1-one |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 654.2ºC at 760mmHg |
| Molecular Formula | C34H50N2O2 |
| Molecular Weight | 518.77300 |
| Flash Point | 243.9ºC |
| Exact Mass | 518.38700 |
| PSA | 40.62000 |
| LogP | 8.01100 |
| Index of Refraction | 1.545 |
| InChIKey | USDCTBWPLCVPHA-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)C1C(c2ccc(N(C)C)cc2)CC(=O)C(CCCCC)C1c1ccc(N(C)C)cc1 |
|
~%
3,5-bis[4-(dime... CAS#:54951-60-9 |
| Literature: Dimmock; Taylor Journal of Pharmaceutical Sciences, 1975 , vol. 64, # 2 p. 241 - 249 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |