2-(2-Ethoxyphenyl)-4,5-diphenyl-1H-imidazole structure
|
Common Name | 2-(2-Ethoxyphenyl)-4,5-diphenyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 5496-42-4 | Molecular Weight | 340.41800 | |
| Density | 1.144g/cm3 | Boiling Point | 552.5ºC at 760 mmHg | |
| Molecular Formula | C23H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.7ºC | |
| Name | 2-(2-Ethoxyphenyl)-4,5-diphenyl-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 552.5ºC at 760 mmHg |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.41800 |
| Flash Point | 193.7ºC |
| Exact Mass | 340.15800 |
| PSA | 37.91000 |
| LogP | 5.80940 |
| Index of Refraction | 1.615 |
| InChIKey | XCCJHWPREGFUJH-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-o-Ethoxyphenyl-4,5-diphenyl-imidazol |
| MFCD05987672 |