2-(2-Methoxyphenyl)-4,5-diphenyl-1H-imidazole structure
|
Common Name | 2-(2-Methoxyphenyl)-4,5-diphenyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 1965-19-1 | Molecular Weight | 326.39100 | |
| Density | 1.162 g/cm3 | Boiling Point | 544.3ºC at 760 mmHg | |
| Molecular Formula | C22H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 2-(2-Methoxyphenyl)-4,5-diphenyl-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162 g/cm3 |
|---|---|
| Boiling Point | 544.3ºC at 760 mmHg |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.39100 |
| Flash Point | 191.2ºC |
| Exact Mass | 326.14200 |
| PSA | 37.91000 |
| LogP | 5.41930 |
| Vapour Pressure | 2.35E-11mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | XIOGJAPOAUEYJO-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| HS Code | 2933290090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(O-METHOXY)-4,5-DIPHENYLIMIDAZOLE |
| 4,5-dihydro-2-(2-methoxyphenyl)-1H-imidazole |
| 2-(2-methoxy-phenyl)-4,5-diphenyl-1H-imidazole |
| 4,5-Diphenyl-2-(2-methoxyphenyl)-1H-imidazole |
| 2-(2-METHOXY)-4,5-DIPHENYLIMIDAZOLE |
| 2-(O-METHOXY)PHENYL-4,5-DIPHENYLIMIDAZOLE |
| 2-o-Anisyl-4,5-diphenylimidazol |
| MFCD02927744 |
| 2-(2-METHOXYPHENYL)-4,5-DIPHENYLIMIDAZOLE |
| 2-(2-Methoxyphenyl)-4,5-diphenyl-imidazol |
| EINECS 217-810-7 |
| Methyl-2-Amino-3,5-Diphenylimidazole |