Urea, N- (2-chlorophenyl)-N-(2-methoxyphenyl)- structure
|
Common Name | Urea, N- (2-chlorophenyl)-N-(2-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 54964-89-5 | Molecular Weight | 276.71800 | |
| Density | 1.344g/cm3 | Boiling Point | 324.3ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150ºC | |
| Name | 1-(2-chlorophenyl)-3-(2-methoxyphenyl)urea |
|---|
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 324.3ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.71800 |
| Flash Point | 150ºC |
| Exact Mass | 276.06700 |
| PSA | 50.36000 |
| LogP | 4.13860 |
| Index of Refraction | 1.667 |
| InChIKey | QFGFWIFBPJMEES-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)Nc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
Urea, N- (2-chl... CAS#:54964-89-5 |
| Literature: Sah Journal of the Chinese Chemical Society (Peking), 1946 , vol. 13, p. 22,26,27 Recueil des Travaux Chimiques des Pays-Bas, 1940 , vol. 59, p. 231,233,234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |