cumyluron
cumyluron structure
|
Common Name | cumyluron | ||
|---|---|---|---|---|
| CAS Number | 99485-76-4 | Molecular Weight | 302.8 | |
| Density | 1.164 g/cm3 | Boiling Point | 503ºC at 760 mmHg | |
| Molecular Formula | C17H19ClN2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 258ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | cumyluron |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.164 g/cm3 |
|---|---|
| Boiling Point | 503ºC at 760 mmHg |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.8 |
| Flash Point | 258ºC |
| Exact Mass | 302.1185909 |
| PSA | 41.57000 |
| LogP | 2.66500 |
| Index of Refraction | 1.575 |
| InChIKey | VYNOULHXXDFBLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)NC(=O)NCC2=CC=CC=C2Cl |
| Storage condition | 0-6°C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-[(2-chlorophenyl)methyl]-3-(2-phenylpropan-2-yl)urea |
| Cumyluron |
| Cumyluron [ISO] |
| Urea,N-[(2-chlorophenyl)methyl]-N'-(1-methyl-1-phenylethyl) |
| N-[(2-chlorophenyl)methyl]-N’-(1-methyl-1-phenylethyl)urea |
| cumyleron |
| 1-(2-chlorobenzyl)-3-(1-methyl-1-phenylethyl)urea |
| N-[(2-chlorophenyl)methyl]-N’-(2-phenylpropan-2-yl)urea |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of cumyluron? |
| A: Molecular formula of cumyluron is C17H19ClN2O. |
| Q: What is the polar surface area (PSA) of cumyluron? |
| A: Polar surface area (PSA) of cumyluron is 41.57000. |
| Q: What is the CAS number of cumyluron? |
| A: CAS number of cumyluron is 99485-76-4. |
| Q: What is the SMILES notation of cumyluron? |
| A: SMILES notation of cumyluron is CC(C)(C1=CC=CC=C1)NC(=O)NCC2=CC=CC=C2Cl. |
| Q: What is the safety information for cumyluron? |
| A: Safety information for cumyluron: 61. |
| Q: What are the storage conditions for cumyluron? |
| A: Storage conditions for cumyluron: 0-6°C. |
| Q: What English synonyms does cumyluron have? |
| A: English synonyms of cumyluron: 1-[(2-chlorophenyl)methyl]-3-(2-phenylpropan-2-yl)urea, Cumyluron, Cumyluron [ISO], Urea,N-[(2-chlorophenyl)methyl]-N'-(1-methyl-1-phenylethyl), N-[(2-chlorophenyl)methyl]-N’-(1-methyl-1-phenylethyl)urea, cumyleron, 1-(2-chlorobenzyl)-3-(1-methyl-1-phenylethyl)urea, N-[(2-chlorophenyl)methyl]-N’-(2-phenylpropan-2-yl)urea. |
| Q: What is the boiling point of cumyluron? |
| A: Boiling point of cumyluron is 503ºC at 760 mmHg. |
| Q: What is the English name of cumyluron? |
| A: The English name of cumyluron is cumyluron. |
| Q: What is the LogP of cumyluron? |
| A: LogP of cumyluron is 2.66500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |