3-[(4-chlorophenyl)methylideneamino]-1,1-dimethyl-urea structure
|
Common Name | 3-[(4-chlorophenyl)methylideneamino]-1,1-dimethyl-urea | ||
|---|---|---|---|---|
| CAS Number | 5499-37-6 | Molecular Weight | 225.67500 | |
| Density | 1.18g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(E)-(4-chlorophenyl)methylideneamino]-1,1-dimethylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.67500 |
| Exact Mass | 225.06700 |
| PSA | 44.70000 |
| LogP | 2.33600 |
| Index of Refraction | 1.557 |
| InChIKey | QIISRYVRKLRDRO-KPKJPENVSA-N |
| SMILES | CN(C)C(=O)NN=Cc1ccc(Cl)cc1 |
|
~%
3-[(4-chlorophe... CAS#:5499-37-6 |
| Literature: Warren; Woodward; Hargreaves Journal of Medicinal Chemistry, 1977 , vol. 20, # 11 p. 1520 - 1521 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-benzaldehyd-<4,4-dimethyl-semicarbazon> |