1-(3,5-dimethoxyphenyl)-2-hydroxy-2-phenylethanone structure
|
Common Name | 1-(3,5-dimethoxyphenyl)-2-hydroxy-2-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 54996-39-3 | Molecular Weight | 272.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,5-dimethoxyphenyl)-2-hydroxy-2-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O4 |
|---|---|
| Molecular Weight | 272.29600 |
| Exact Mass | 272.10500 |
| PSA | 55.76000 |
| LogP | 2.62010 |
| InChIKey | JPZYXFXMPXQXBD-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(C(=O)C(O)c2ccccc2)c1 |
|
~%
1-(3,5-dimethox... CAS#:54996-39-3 |
| Literature: Corrie, John E. T.; Trentham, David R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 18 p. 2409 - 2418 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Ethanone,1-(3,5-dimethoxyphenyl)-2-hydroxy-2-phenyl |
| 3',5'-dimethoxybenzoin |