L-Methyldopa
L-Methyldopa structure
|
Common Name | L-Methyldopa | ||
|---|---|---|---|---|
| CAS Number | 55-40-3 | Molecular Weight | 211.214 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 441.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.6±45.0 °C at 760 mmHg |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.214 |
| Flash Point | 220.9±28.7 °C |
| Exact Mass | 211.084457 |
| PSA | 103.78000 |
| LogP | 0.13 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | CJCSPKMFHVPWAR-UHFFFAOYSA-N |
| SMILES | CC(N)(Cc1ccc(O)c(O)c1)C(=O)O |
| Storage condition | −20°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Tetrahedron Letters, , vol. 23, # 41 p. 4259 - 4262 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Tetrahedron Letters, , vol. 23, # 41 p. 4259 - 4262 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Tetrahedron Letters, , vol. 23, # 41 p. 4259 - 4262 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Chemical and pharmaceutical bulletin, , vol. 13, # 12 p. 1399 - 1407 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| a-Methyl-L-dopa |
| α-Methyl-L-dopa |
| Dopegyt |
| 3-(3,4-Dihydroxyphenyl)-2-methyl alanine |
| L-(-)-b-(3,4-Dihydroxyphenyl)-a-methylalanine |
| L-(-)-α-Methyl-β-(3,4-dihydroxyphenyl)alanine |
| L-(-)-a-Methyl-b-(3,4-dihydroxyphenyl)alanine |
| rac Alpha-Methyl DOPA |
| 2-Methyl-3-(3,4-dihydroxyphenyl)-DL-alanine |
| a-Methyl Dopa |
| (+)-α-Methyldopa |
| UNII:33TD13T99R |
| α-Methyl dopa |
| 3-Hydroxy-α-methyltyrosine |
| L-(a-Md) |
| L-α-Methyldopa |
| (-)-α-Methyldopa |
| 3-Hydroxy-α-methyl-L-tyrosine |
| Dopamet |
| (S)-(-)-a-Methyldopa |
| a-Methyl-b-(3,4-dihydroxyphenyl)-L-alanine |
| Bayer 1440L |
| MFCD00065917 |
| Methyl dopa |
| Aldomet |
| EINECS 200-232-4 |
| l-a-Methyldopa |
| (S)-a-Methyldopa |
| ALDORIL |
| Methyldopa |
| L-a-Methyl-3,4-dihydroxyphenylalanine |
| (-)-Methyldopa |
| Elanpres |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: Polar surface area (PSA) of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is 103.78000. |
| Q: What are the upstream materials of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: Related upstream materials(CAS) of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine: 84713-76-8;23234-41-5;84713-73-5;5934-66-7. |
| Q: What is the molecular formula of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: Molecular formula of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is C10H13NO4. |
| Q: What is the English name of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: The English name of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine. |
| Q: What is the LogP of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: LogP of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is 0.13. |
| Q: What is the safety information for 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: Safety information for 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine: S26-S37/39. |
| Q: What is the boiling point of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: Boiling point of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is 441.6±45.0 °C at 760 mmHg. |
| Q: What is the CAS number of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: CAS number of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is 55-40-3. |
| Q: What is the InChIKey of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: InChIKey of 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine is CJCSPKMFHVPWAR-UHFFFAOYSA-N. |
| Q: What are the storage conditions for 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine? |
| A: Storage conditions for 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine: −20°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |