L-Methyldopa structure
|
Common Name | L-Methyldopa | ||
|---|---|---|---|---|
| CAS Number | 55-40-3 | Molecular Weight | 211.214 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 441.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9±28.7 °C | |
| Name | 2-methyl-3-(3,4-dihydroxyphenyl)-dl-alanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.6±45.0 °C at 760 mmHg |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.214 |
| Flash Point | 220.9±28.7 °C |
| Exact Mass | 211.084457 |
| PSA | 103.78000 |
| LogP | 0.13 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | CJCSPKMFHVPWAR-UHFFFAOYSA-N |
| SMILES | CC(N)(Cc1ccc(O)c(O)c1)C(=O)O |
| Storage condition | −20°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Tetrahedron Letters, , vol. 23, # 41 p. 4259 - 4262 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Tetrahedron Letters, , vol. 23, # 41 p. 4259 - 4262 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Tetrahedron Letters, , vol. 23, # 41 p. 4259 - 4262 |
|
~%
L-Methyldopa CAS#:55-40-3 |
| Literature: Chemical and pharmaceutical bulletin, , vol. 13, # 12 p. 1399 - 1407 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| a-Methyl-L-dopa |
| α-Methyl-L-dopa |
| Dopegyt |
| 3-(3,4-Dihydroxyphenyl)-2-methyl alanine |
| L-(-)-b-(3,4-Dihydroxyphenyl)-a-methylalanine |
| L-(-)-α-Methyl-β-(3,4-dihydroxyphenyl)alanine |
| L-(-)-a-Methyl-b-(3,4-dihydroxyphenyl)alanine |
| rac Alpha-Methyl DOPA |
| 2-Methyl-3-(3,4-dihydroxyphenyl)-DL-alanine |
| a-Methyl Dopa |
| (+)-α-Methyldopa |
| UNII:33TD13T99R |
| α-Methyl dopa |
| 3-Hydroxy-α-methyltyrosine |
| L-(a-Md) |
| L-α-Methyldopa |
| (-)-α-Methyldopa |
| 3-Hydroxy-α-methyl-L-tyrosine |
| Dopamet |
| (S)-(-)-a-Methyldopa |
| a-Methyl-b-(3,4-dihydroxyphenyl)-L-alanine |
| Bayer 1440L |
| MFCD00065917 |
| Methyl dopa |
| Aldomet |
| EINECS 200-232-4 |
| l-a-Methyldopa |
| (S)-a-Methyldopa |
| ALDORIL |
| Methyldopa |
| L-a-Methyl-3,4-dihydroxyphenylalanine |
| (-)-Methyldopa |
| Elanpres |