3-Phenyl-1H-pyrazole-4-carboxylic acid structure
|
Common Name | 3-Phenyl-1H-pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5504-65-4 | Molecular Weight | 188.18300 | |
| Density | 1.356g/cm3 | Boiling Point | 429.978ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | 278ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 213.843ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-phenyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.356g/cm3 |
|---|---|
| Boiling Point | 429.978ºC at 760 mmHg |
| Melting Point | 278ºC (dec.)(lit.) |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 213.843ºC |
| Exact Mass | 188.05900 |
| PSA | 65.98000 |
| LogP | 1.77490 |
| Index of Refraction | 1.645 |
| InChIKey | LGTJKUYVFSBOMC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cn[nH]c1-c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xi |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: High-throughput screen for inhibitors of the GIV GBA-motif interaction with Galpha-i ...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS1303
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 3-Phenyl-1(2)H-pyrazol-4-carbonsaeure |
| 3(5)-Phenylpyrazole-4-carboxylic acid |
| 3-phenyl-1(2)H-pyrazole-4-carboxylic acid |
| MFCD06798067 |
| 3-Phenylpyrazol-4-carbonsaeure |
| 3-phenyl-1H-pyrazole-4-carboxylic acid |