3-Methylbenzoic acid phenacyl ester structure
|
Common Name | 3-Methylbenzoic acid phenacyl ester | ||
|---|---|---|---|---|
| CAS Number | 55153-20-3 | Molecular Weight | 254.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl 3-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O3 |
|---|---|
| Molecular Weight | 254.28100 |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.03470 |
| InChIKey | YWTZIPIBXULXBW-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)OCC(=O)c2ccccc2)c1 |
| HS Code | 2916399090 |
|---|
|
~78%
3-Methylbenzoic... CAS#:55153-20-3 |
| Literature: Reddi, Rambabu N.; Malekar, Pushpa V.; Sudalai, Arumugam Organic and Biomolecular Chemistry, 2013 , vol. 11, # 38 p. 6477 - 6482 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-oxo-2-phenylethyl-3-methylbenzoate |
| Phenacyl-m-methylbenzoat |
| Benzoic acid,3-methyl-,2-oxo-2-phenylethyl ester |