p-Decyloxybenzoic Acid structure
|
Common Name | p-Decyloxybenzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 5519-23-3 | Molecular Weight | 278.387 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 403.6±18.0 °C at 760 mmHg | |
| Molecular Formula | C17H26O3 | Melting Point | 94-143 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.7±14.7 °C | |
| Name | 4-(Decyloxy)benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.6±18.0 °C at 760 mmHg |
| Melting Point | 94-143 °C(lit.) |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.387 |
| Flash Point | 138.7±14.7 °C |
| Exact Mass | 278.188202 |
| PSA | 46.53000 |
| LogP | 6.74 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | NZNICZRIRMGOFG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Decyloxybenzoic Acid |
| 4-decoxybenzoic acid |
| MFCD00020360 |
| 4-(Decyloxy)benzoic acid |
| Benzoic acid, 4-(decyloxy)- |