3,3',4,4',5,5'-hexahydroxy-2,2'-methylenedi(benzoic acid)
Modify Date: 2025-08-25 09:10:37
3,3',4,4',5,5'-hexahydroxy-2,2'-methylenedi(benzoic acid) structure
|
Common Name | 3,3',4,4',5,5'-hexahydroxy-2,2'-methylenedi(benzoic acid) | ||
|---|---|---|---|---|
| CAS Number | 552-21-6 | Molecular Weight | 352.25000 | |
| Density | 1.909g/cm3 | Boiling Point | 820.9ºC at 760 mmHg | |
| Molecular Formula | C15H12O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 464.1ºC | |
| Name | 2-[(6-carboxy-2,3,4-trihydroxyphenyl)methyl]-3,4,5-trihydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.909g/cm3 |
|---|---|
| Boiling Point | 820.9ºC at 760 mmHg |
| Molecular Formula | C15H12O10 |
| Molecular Weight | 352.25000 |
| Flash Point | 464.1ºC |
| Exact Mass | 352.04300 |
| PSA | 195.98000 |
| LogP | 0.90740 |
| Index of Refraction | 1.825 |
| InChIKey | HEFYRPDDQCAYRU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1Cc1c(C(=O)O)cc(O)c(O)c1O |
| HS Code | 2918290000 |
|---|
|
~%
3,3',4,4',5,5'-... CAS#:552-21-6 |
| Literature: Baeyer Chemische Berichte, 1872 , vol. 5, p. 1098 |
|
~%
3,3',4,4',5,5'-... CAS#:552-21-6 |
| Literature: Moehlau; Kahl Chemische Berichte, 1898 , vol. 31, p. 271 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2,2'-methylenebis[3,4,5-trihydroxy |
| 3,3',4,4',5,5'-hexahydroxy-2,2'-methylenedi(benzoic acid) |
| EINECS 209-005-4 |
| 3,4,5,3',4',5'-hexahydroxy-2,2'-methanediyl-di-benzoic acid |
| Methylenedigallic acid |
| 2,2'-methylenebis(3,4,5-trihydroxybenzoic acid) |
| 3,4,5,3',4',5'-Hexahydroxy-2,2'-methandiyl-di-benzoesaeure |