thymol iodide structure
|
Common Name | thymol iodide | ||
|---|---|---|---|---|
| CAS Number | 552-22-7 | Molecular Weight | 550.21200 | |
| Density | 1.617g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H24I2O2 | Melting Point | 69ºC | |
| MSDS | Chinese USA | Flash Point | STABILITY | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of thymol iodideThymol iodide is a compound of Iodide and Thymol. Thymol iodide acts as a substitute for iodoform[1]. Thymol iodide is an iodine derivative of Thymol (a phenol derived from thyme oil), which is mostly used as mild antiseptic and fungicide[2]. |
| Name | [4-(4-iodooxy-2-methyl-5-propan-2-ylphenyl)-5-methyl-2-propan-2-ylphenyl] hypoiodite |
|---|---|
| Synonym | More Synonyms |
| Description | Thymol iodide is a compound of Iodide and Thymol. Thymol iodide acts as a substitute for iodoform[1]. Thymol iodide is an iodine derivative of Thymol (a phenol derived from thyme oil), which is mostly used as mild antiseptic and fungicide[2]. |
|---|---|
| Related Catalog | |
| References |
[1]. Gupta PC. Use of Thymol Iodide in Interstitial Keratitis. Ind Med Gaz. 1931 May;66(5):267-268. |
| Density | 1.617g/cm3 |
|---|---|
| Melting Point | 69ºC |
| Molecular Formula | C20H24I2O2 |
| Molecular Weight | 550.21200 |
| Flash Point | STABILITY |
| Exact Mass | 549.98700 |
| PSA | 18.46000 |
| LogP | 7.67480 |
| Index of Refraction | 1.616 |
| InChIKey | SHOKWSLXDAIZPP-UHFFFAOYSA-N |
| SMILES | Cc1cc(OI)c(C(C)C)cc1-c1cc(C(C)C)c(OI)cc1C |
| Storage condition | 2-8°C |
| Stability | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2908199090 |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| MFCD00026409 |
| Iodistol |
| Annidalin |
| Iothymol |
| 4,4'-Bis(iodooxy)-2,2'-dimethyl-5,5'-bis(1-methylethyl)-1,1'-biphenyl |
| Aristol |
| EINECS 209-007-5 |
| THYMOL IODIDE |
| Iodohydromol |
| Iodosol |
| Thymiode |
| Lothymol |
| Iodothymol |