N-(3,5-dichloro-2-hydroxy-4-methylphenyl)acetamide
Modify Date: 2025-09-25 21:53:25
N-(3,5-dichloro-2-hydroxy-4-methylphenyl)acetamide structure
|
Common Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 55202-11-4 | Molecular Weight | 234.07900 | |
| Density | 1.452 g/cm3 | Boiling Point | 366.9ºC at 760 mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452 g/cm3 |
|---|---|
| Boiling Point | 366.9ºC at 760 mmHg |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.07900 |
| Flash Point | 175.7ºC |
| Exact Mass | 233.00100 |
| PSA | 49.33000 |
| LogP | 3.03880 |
| Index of Refraction | 1.625 |
| InChIKey | XWRFOWUTIDNAEO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Cl)c(C)c(Cl)c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetylamino-5-methyl-4,6-dichlorphenol |
| 6-Acetamino-2,4-dichloro-3-methylphenol |