N-(3,5-dichloro-2-hydroxyphenyl)acetamide
N-(3,5-dichloro-2-hydroxyphenyl)acetamide structure
|
Common Name | N-(3,5-dichloro-2-hydroxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 55202-45-4 | Molecular Weight | 220.05300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3,5-dichloro-2-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7Cl2NO2 |
|---|---|
| Molecular Weight | 220.05300 |
| Exact Mass | 218.98500 |
| PSA | 52.82000 |
| LogP | 3.30690 |
| InChIKey | LLEDDIDLLAPZNE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Cl)cc(Cl)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
N-(3,5-dichloro... CAS#:55202-45-4 |
| Literature: Kelly et al. Journal of Organic Chemistry, 1983 , vol. 48, p. 3849 |
|
~%
N-(3,5-dichloro... CAS#:55202-45-4 |
| Literature: Brown; McCall Journal of the Chemical Society, 1955 , p. 3681,3683 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:33353-68-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dichlor-2,4-acetamido-6-phenol |
| 2-Acetylamino-4,6-dichlor-phenol |
| 2-acetamido-4,6-dichlorophenol |
| Essigsaeure-(3,5-dichlor-2-hydroxy-anilid) |
| acetic acid-(3,5-dichloro-2-hydroxy-anilide) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: CAS number of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is 55202-45-4. |
| Q: What is the molecular formula of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: Molecular formula of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is C8H7Cl2NO2. |
| Q: What is the SMILES notation of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: SMILES notation of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is CC(=O)Nc1cc(Cl)cc(Cl)c1O. |
| Q: What is the LogP of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: LogP of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is 3.30690. |
| Q: What is the polar surface area (PSA) of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: Polar surface area (PSA) of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is 52.82000. |
| Q: What are the downstream products of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: Related downstream products(CAS) of N-(3,5-dichloro-2-hydroxyphenyl)acetamide: 33353-68-3. |
| Q: What is the molecular weight of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: Molecular weight of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is 220.05300. |
| Q: What is the English name of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: The English name of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is N-(3,5-dichloro-2-hydroxyphenyl)acetamide. |
| Q: What is the Chinese name of 55202-45-4? |
| A: Chinese name of 55202-45-4 is 55202-45-4. |
| Q: What is the InChIKey of N-(3,5-dichloro-2-hydroxyphenyl)acetamide? |
| A: InChIKey of N-(3,5-dichloro-2-hydroxyphenyl)acetamide is LLEDDIDLLAPZNE-UHFFFAOYSA-N. |