2,4-Dichloro-6-nitrophenol structure
|
Common Name | 2,4-Dichloro-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 609-89-2 | Molecular Weight | 207.999 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 242.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl2NO3 | Melting Point | 118-120 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 100.6±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Dichloro-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 242.8±35.0 °C at 760 mmHg |
| Melting Point | 118-120 °C(lit.) |
| Molecular Formula | C6H3Cl2NO3 |
| Molecular Weight | 207.999 |
| Flash Point | 100.6±25.9 °C |
| Exact Mass | 206.949005 |
| PSA | 66.05000 |
| LogP | 3.41 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | LYPMXMBQPXPNIQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(Cl)c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R41 |
| Safety Phrases | S26-S36/37/39-S28 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | SL0350000 |
| Packaging Group | III |
| Hazard Class | 4.1 |
| HS Code | 2908999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Immunocytochemical localization and biological activity of hydroxysteroid sulfotransferase in the frog brain.
J. Neurochem. 72(2) , 848-57, (1999) Biosynthesis of the neuroactive steroids pregnenolone sulfate (delta5PS) and dehydroepiandrosterone sulfate (DHEAS) is catalyzed by the enzyme hydroxysteroid sulfotransferase (HST), which transfers th... |
|
|
FTIR, FT-Raman spectra and ab initio DFT vibrational analysis of 2,4-dichloro-6-nitrophenol.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 65(5) , 1053-62, (2006) The FTIR and FT-Raman spectra of 2,4-dichloro-6-nitrophenol (2,4-DC6NP) has been recorded in the region 4000-400 cm(-1) and 3500-100 cm(-1), respectively. The optimized geometry, frequency and intensi... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2,4-Dichlor-6-nitro-phenol |
| Phenol,2,4-dichloro-6-nitro |
| 2,4-Dichloro-6-nitrophenol |
| 2,4,5-TRIFLUOROBENZOICACID METHYL ESTER |
| 4.6-Dichlor-2-nitro-1-hydroxy-benzol |
| 4,6-Dichloro-2-nitrophenol |
| 2,4-dichloro-6-nitro-phenol |
| 2-nitro-4,6-dichlorophenol |
| EINECS 210-202-2 |
| 6-nitro-2,4-dichlorophenol |
| MFCD00007101 |
| 2,4-Dichlor-6-nitrofenol |