3-Methyl-7-propylxanthine structure
|
Common Name | 3-Methyl-7-propylxanthine | ||
|---|---|---|---|---|
| CAS Number | 55242-64-3 | Molecular Weight | 208.21700 | |
| Density | 1.44 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N4O2 | Melting Point | 104-109 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methyl-7-propylxanthine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44 g/cm3 |
|---|---|
| Melting Point | 104-109 °C |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.21700 |
| Exact Mass | 208.09600 |
| PSA | 72.68000 |
| Index of Refraction | 1.675 |
| InChIKey | MHNVSFOURBQRPK-UHFFFAOYSA-N |
| SMILES | CCCn1cnc2c1c(=O)[nH]c(=O)n2C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S37/39-S26-S36 |
| HS Code | 2933990090 |
|
~96%
3-Methyl-7-prop... CAS#:55242-64-3 |
| Literature: Ohsaki; Kuriki; Ueda; Sakakibara; Asano Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 3 p. 877 - 892 |
|
~%
3-Methyl-7-prop... CAS#:55242-64-3 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 36, # 3 p. 877 - 892 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02089337 |
| 3-methyl-7-propylpurine-2,6-dione |