2,6-Dibromospiro[3.3]heptane-2,6-dicarboxylic ac structure
|
Common Name | 2,6-Dibromospiro[3.3]heptane-2,6-dicarboxylic ac | ||
|---|---|---|---|---|
| CAS Number | 55249-70-2 | Molecular Weight | 398.08800 | |
| Density | 1.65g/cm3 | Boiling Point | 369.3ºC at 760mmHg | |
| Molecular Formula | C13H18Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.2ºC | |
| Name | diethyl 2,6-dibromospiro[3.3]heptane-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 369.3ºC at 760mmHg |
| Molecular Formula | C13H18Br2O4 |
| Molecular Weight | 398.08800 |
| Flash Point | 177.2ºC |
| Exact Mass | 395.95700 |
| PSA | 52.60000 |
| LogP | 2.95400 |
| Index of Refraction | 1.557 |
| InChIKey | XAMKLIDFYSWIFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(Br)CC2(C1)CC(Br)(C(=O)OCC)C2 |
|
~%
2,6-Dibromospir... CAS#:55249-70-2 |
| Literature: Hulshof,L.A.; Wynberg,H. Journal of the American Chemical Society, 1974 , vol. 96, # 7 p. 2191 - 2200 |
|
~%
2,6-Dibromospir... CAS#:55249-70-2 |
| Literature: Backer; Kemper Recueil des Travaux Chimiques des Pays-Bas, 1938 , vol. 57, p. 761,765, 766 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,6-Dibrom-spiro[3.3]heptan-2,6-dicarbonsaeure-diaethylester |
| 2,6-dibromo-spiro[3.3]heptane-2,6-dicarboxylic acid diethyl ester |