2,3,6-Trichloro-5-nitropyridine structure
|
Common Name | 2,3,6-Trichloro-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 55304-72-8 | Molecular Weight | 227.433 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 301.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C5HCl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9±26.5 °C | |
| Name | 2,3,6-Trichloro-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.1±37.0 °C at 760 mmHg |
| Molecular Formula | C5HCl3N2O2 |
| Molecular Weight | 227.433 |
| Flash Point | 135.9±26.5 °C |
| Exact Mass | 225.910355 |
| PSA | 58.71000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | KPXAMNWVBHLRRG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)nc1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2811.0 |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
|
~%
2,3,6-Trichloro... CAS#:55304-72-8 |
| Literature: Ciba-Geigy Corporation Patent: US3974166 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,6-Trichlor-5-nitro-pyridin |
| 2,5,6-Trichloro-3-nitropyridine |
| 2,3,6-tris(chloranyl)-5-nitro-pyridine |
| Pyridine, 2,3,6-trichloro-5-nitro- |
| 2,3,6-Trichloro-5-nitropyridine |
| 2,3,6-Trichloro-5-nitro-pyridine |
| 3-nitro-2,5,6-trichloropyridine |