2,2',3,4,5-Pentachlorobiphenyl structure
|
Common Name | 2,2',3,4,5-Pentachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 55312-69-1 | Molecular Weight | 326.43300 | |
| Density | 1.522g/cm3 | Boiling Point | 375ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl5 | Melting Point | 100°C | |
| MSDS | N/A | Flash Point | 180.8ºC | |
| Name | 2,2',3,4,5-Pentachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 375ºC at 760 mmHg |
| Melting Point | 100°C |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.43300 |
| Flash Point | 180.8ºC |
| Exact Mass | 323.88300 |
| LogP | 6.62060 |
| Index of Refraction | 1.619 |
| InChIKey | AIURIRUDHVDRFQ-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1-c1cc(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2903999010 |
|---|
|
~%
2,2',3,4,5-Pent... CAS#:55312-69-1 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| 1,2,3,4-tetrachloro-5-(2-chlorophenyl)benzene |