(S)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine structure
|
Common Name | (S)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 553638-66-7 | Molecular Weight | 293.44600 | |
| Density | 1.004g/cm3 | Boiling Point | 410ºC at 760 mmHg | |
| Molecular Formula | C21H27N | Melting Point | 97-101ºC | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | (2S)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine |
|---|
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760 mmHg |
| Melting Point | 97-101ºC |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.44600 |
| Flash Point | 208.4ºC |
| Exact Mass | 293.21400 |
| PSA | 12.03000 |
| LogP | 5.13290 |
| Index of Refraction | 1.561 |
| InChIKey | PHKHWUVAUXBNPC-FQEVSTJZSA-N |
| SMILES | Cc1cc(C)cc(C(c2cc(C)cc(C)c2)C2CCCN2)c1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |