3-bicyclo[2.2.1]heptanyl-[4-(4-nitrophenyl)piperazin-1-yl]methanone structure
|
Common Name | 3-bicyclo[2.2.1]heptanyl-[4-(4-nitrophenyl)piperazin-1-yl]methanone | ||
|---|---|---|---|---|
| CAS Number | 5540-69-2 | Molecular Weight | 329.39400 | |
| Density | 1.281g/cm3 | Boiling Point | 553.5ºC at 760mmHg | |
| Molecular Formula | C18H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.6ºC | |
| Name | 3-bicyclo[2.2.1]heptanyl-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 553.5ºC at 760mmHg |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.39400 |
| Flash Point | 288.6ºC |
| Exact Mass | 329.17400 |
| PSA | 69.37000 |
| LogP | 3.20570 |
| Index of Refraction | 1.612 |
| InChIKey | AJIXIENUVVGOBB-UHFFFAOYSA-N |
| SMILES | O=C(C1CC2CCC1C2)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
|
~%
3-bicyclo[2.2.1... CAS#:5540-69-2 |
| Literature: Glasser; Doughty Journal of medicinal chemistry, 1966 , vol. 9, # 3 p. 351 - 353 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |