Jujuboside B structure
|
Common Name | Jujuboside B | ||
|---|---|---|---|---|
| CAS Number | 55466-05-2 | Molecular Weight | 1045.211 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C52H84O21 | Melting Point | 228-231ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Jujuboside BJujuboside B is one of the major bioactive constituents isolated from Zizyphus jujuba. Jujuboside B can inhibit platelet aggregation[1]. |
| Name | Jujuboside B |
|---|---|
| Synonym | More Synonyms |
| Description | Jujuboside B is one of the major bioactive constituents isolated from Zizyphus jujuba. Jujuboside B can inhibit platelet aggregation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | 228-231ºC |
| Molecular Formula | C52H84O21 |
| Molecular Weight | 1045.211 |
| Exact Mass | 1044.550537 |
| PSA | 314.83000 |
| LogP | 7.53 |
| Index of Refraction | 1.628 |
| InChIKey | OAVAUZCEOWCYCC-QEOGCQCLSA-N |
| SMILES | CC(C)=CC1CC(C)(O)C2C3CCC4C5(C)CCC(OC6OCC(O)C(OC7OC(CO)C(O)C(O)C7OC7OCC(O)C(O)C7O)C6OC6OC(C)C(O)C(O)C6O)C(C)(C)C5CCC4(C)C34COC2(C4)O1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| JujubosideB |
| (3β,16β,23R)-20-Hydroxy-16,23:16,30-diepoxydammar-24-en-3-yl 6-deoxy-α-L-mannopyranosyl-(1->2)-[β-D-xylopyranosyl-(1->2)-β-D-glucopyranosyl-(1->;3)]-α-L-arabinopyranoside |
| Jujuboside |