Isosaxalin structure
|
Common Name | Isosaxalin | ||
|---|---|---|---|---|
| CAS Number | 55481-86-2 | Molecular Weight | 322.74 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 531.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H15ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1±30.1 °C | |
Use of IsosaxalinIsosaxalin is a natural product isolated from Murraya koeningii[1]. |
| Name | 9-{[(2R)-3-Chloro-2-hydroxy-3-methylbutyl]oxy}-7H-furo[3,2-g]chro men-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Isosaxalin is a natural product isolated from Murraya koeningii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.2±50.0 °C at 760 mmHg |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74 |
| Flash Point | 275.1±30.1 °C |
| Exact Mass | 322.060791 |
| PSA | 72.81000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | VNNTVHKCIBWHDR-UHFFFAOYSA-N |
| SMILES | CC(C)(Cl)C(O)COc1c2occc2cc2ccc(=O)oc12 |
| Hazard Codes | Xi |
|---|
| 8-<3-Ethoxycarbonyl-2-octyl-1-cyclopropenyl>-octansaeure-methylester |
| 7H-Furo[3,2-g][1]benzopyran-7-one, 9-[(2R)-3-chloro-2-hydroxy-3-methylbutoxy]- |
| 9-[(2R)-3-Chloro-2-hydroxy-3-methylbutoxy]-7H-furo[3,2-g]chromen-7-one |