D-3-THIENYLALANINE structure
|
Common Name | D-3-THIENYLALANINE | ||
|---|---|---|---|---|
| CAS Number | 55502-03-9 | Molecular Weight | 274.11100 | |
| Density | 1.458g/cm3 | Boiling Point | 165-170ºC (0.5 mmHg) | |
| Molecular Formula | C10H12BrNO3 | Melting Point | 37-40ºC | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 1-(4-Bromobutoxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 165-170ºC (0.5 mmHg) |
| Melting Point | 37-40ºC |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11100 |
| Flash Point | 186.7ºC |
| Exact Mass | 273.00000 |
| PSA | 55.05000 |
| LogP | 3.67190 |
| Index of Refraction | 1.563 |
| InChIKey | DBRBCFJUEVSKGZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCCBr)cc1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 36/37/38-22 |
| Safety Phrases | 37/39-26 |
|
~93%
D-3-THIENYLALANINE CAS#:55502-03-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 53, # 23 p. 8376 - 8386 |
|
~%
D-3-THIENYLALANINE CAS#:55502-03-9 |
| Literature: Journal of the Chemical Society, , p. 3298,3308 |
|
~%
D-3-THIENYLALANINE CAS#:55502-03-9 |
| Literature: Molecular Pharmacology, , vol. 68, # 5 p. 1254 - 1270 |
| 1-(4-bromobutoxy)-4-nitrobenzene |
| MFCD00980317 |