2-[(2,5-dimethoxyphenyl)methyl]propanedinitrile structure
|
Common Name | 2-[(2,5-dimethoxyphenyl)methyl]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 5553-93-5 | Molecular Weight | 216.23600 | |
| Density | 1.135g/cm3 | Boiling Point | 410.7ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.9ºC | |
| Name | 2-(2,5-dimethoxybenzyl)malononitrile |
|---|
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 170.9ºC |
| Exact Mass | 216.09000 |
| PSA | 66.04000 |
| LogP | 1.90966 |
| Index of Refraction | 1.523 |
| InChIKey | HBPPFRYOLNFRAU-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(CC(C#N)C#N)c1 |
|
~%
2-[(2,5-dimetho... CAS#:5553-93-5 |
| Literature: Westfahl; Gresham Journal of the American Chemical Society, 1955 , vol. 77, p. 2910 |
|
~%
Detail
|
| Literature: Westfahl; Gresham Journal of the American Chemical Society, 76<1954<1076,1078 |