[(2,5-Dimethoxyphenyl)methyl]propanedioic acid structure
|
Common Name | [(2,5-Dimethoxyphenyl)methyl]propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 72018-08-7 | Molecular Weight | 254.23600 | |
| Density | 1.318g/cm3 | Boiling Point | 445ºC at 760 mmHg | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.4ºC | |
| Name | 2-[(2,5-dimethoxyphenyl)methyl]propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 445ºC at 760 mmHg |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.23600 |
| Flash Point | 171.4ºC |
| Exact Mass | 254.07900 |
| PSA | 93.06000 |
| LogP | 1.03170 |
| Index of Refraction | 1.55 |
| InChIKey | HSUUQNZJIBIZOS-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(CC(C(=O)O)C(=O)O)c1 |
|
~42%
[(2,5-Dimethoxy... CAS#:72018-08-7 |
| Literature: Zink, Mario; Lanig, Harald; Troschuetz, Reinhard European Journal of Medicinal Chemistry, 2004 , vol. 39, # 12 p. 1079 - 1088 |
|
~%
[(2,5-Dimethoxy... CAS#:72018-08-7 |
| Literature: Westfahl; Gresham Journal of the American Chemical Society, 1954 , vol. 76, p. 1076,1077 |
|
~%
[(2,5-Dimethoxy... CAS#:72018-08-7 |
| Literature: Baltzly; Buck Journal of the American Chemical Society, 1940 , vol. 62, p. 164,166 Journal of the American Chemical Society, 1942 , vol. 64, p. 3040 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-dimethoxybenzylmalonic acid |
| ((2,5-Dimethoxyphenyl)methyl)propanedioic acid |
| Propanedioic acid,((2,5-dimethoxyphenyl)methyl) |
| Propanedioic acid,2-((2,5-dimethoxyphenyl)methyl) |
| (2,5-Dimethoxy-benzyl)-malonsaeure |