di-tert-butyl 2 6-dimethyl-1 4-dihydrop& structure
|
Common Name | di-tert-butyl 2 6-dimethyl-1 4-dihydrop& | ||
|---|---|---|---|---|
| CAS Number | 55536-71-5 | Molecular Weight | 309.401 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 389.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C17H27NO4 | Melting Point | 142-149ºC | |
| MSDS | Chinese USA | Flash Point | 189.6±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Di-tert-butyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.9±42.0 °C at 760 mmHg |
| Melting Point | 142-149ºC |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.401 |
| Flash Point | 189.6±27.9 °C |
| Exact Mass | 309.194000 |
| PSA | 64.63000 |
| LogP | 3.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | WSWDAKKWVAVVAI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC(C)(C)C)CC(C(=O)OC(C)(C)C)=C(C)N1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~97%
di-tert-butyl 2... CAS#:55536-71-5 |
| Literature: Kumar, Atul; Maurya, Ram Awatar Synlett, 2008 , # 6 p. 883 - 885 |
|
~%
di-tert-butyl 2... CAS#:55536-71-5 |
| Literature: Molecules, , vol. 7, # 7 p. 528 - 533 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Di-tert-butyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Bis(2-methyl-2-propanyl) 2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |
| 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-, bis(1,1-dimethylethyl) ester |
| ditert-butyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |