1,3-Cyclohexanedione, 5-(2,4-dichlorophenyl)- structure
|
Common Name | 1,3-Cyclohexanedione, 5-(2,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 55579-70-9 | Molecular Weight | 257.11300 | |
| Density | 1.371 g/cm3 | Boiling Point | 392.9ºC at 760 mmHg | |
| Molecular Formula | C12H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.1ºC | |
| Name | 5-(2,4-dichlorophenyl)cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371 g/cm3 |
|---|---|
| Boiling Point | 392.9ºC at 760 mmHg |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.11300 |
| Flash Point | 166.1ºC |
| Exact Mass | 256.00600 |
| PSA | 34.14000 |
| LogP | 3.39910 |
| Index of Refraction | 1.577 |
| InChIKey | YZKLUEWQADEGKP-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)CC(c2ccc(Cl)cc2Cl)C1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| hms550i22 |
| 1,3-Cyclohexanedione, 5-(2,4-dichlorophenyl)- |