Z-DL-LYS(Z)-OH structure
|
Common Name | Z-DL-LYS(Z)-OH | ||
|---|---|---|---|---|
| CAS Number | 55592-85-3 | Molecular Weight | 414.45200 | |
| Density | 1.238g/cm3 | Boiling Point | 659ºC at 760mmHg | |
| Molecular Formula | C22H26N2O6 | Melting Point | 90-95ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 352.4ºC | |
| Name | 2,6-bis(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 659ºC at 760mmHg |
| Melting Point | 90-95ºC(lit.) |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.45200 |
| Flash Point | 352.4ºC |
| Exact Mass | 414.17900 |
| PSA | 120.94000 |
| LogP | 3.87150 |
| Index of Refraction | 1.568 |
| InChIKey | BLZXFNUZFTZCFD-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCC(NC(=O)OCc1ccccc1)C(=O)O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
|
~%
Z-DL-LYS(Z)-OH CAS#:55592-85-3 |
| Literature: Journal of Organic Chemistry, , vol. 2, p. 480,481 |
|
~%
Z-DL-LYS(Z)-OH CAS#:55592-85-3 |
| Literature: Journal of Biological Chemistry, , vol. 176, p. 1384 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| DL-N,N-di-CBZ-lysine |
| N|A,N|A-Di-Z-DL-lysine |
| Nalpha,Nepsilon-Di-Z-DL-lysine |
| N,N'-Dibenzyloxycarbonyl-L-lysine |
| Z-DL-LYS(Z)-OH |