N-[4-(3 3 4 4 5 5 6 6 7 7 8 8 8-TRIDECAF structure
|
Common Name | N-[4-(3 3 4 4 5 5 6 6 7 7 8 8 8-TRIDECAF | ||
|---|---|---|---|---|
| CAS Number | 556050-48-7 | Molecular Weight | 595.30800 | |
| Density | 1.585g/cm3 | Boiling Point | 433.897ºC at 760 mmHg | |
| Molecular Formula | C20H14F13NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 216.213ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2,5-dioxopyrrolidin-1-yl) [4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl]methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 433.897ºC at 760 mmHg |
| Molecular Formula | C20H14F13NO5 |
| Molecular Weight | 595.30800 |
| Flash Point | 216.213ºC |
| Exact Mass | 595.06600 |
| PSA | 72.91000 |
| LogP | 6.01310 |
| Index of Refraction | 1.439 |
| InChIKey | XLFQCGUSTBBBAK-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)ON1C(=O)CCC1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
|
~%
N-[4-(3 3 4 4 5... CAS#:556050-48-7 |
| Literature: Curran, Dennis P.; Amatore, Muriel; Guthrie, David; Campbell, Matthew; Go, Eisan; Luo, Zhiyong Journal of Organic Chemistry, 2003 , vol. 68, # 12 p. 4643 - 4647 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| MFCD04973817 |