N-ethyl-2-(1H-indol-3-yl)-2-oxoacetamide structure
|
Common Name | N-ethyl-2-(1H-indol-3-yl)-2-oxoacetamide | ||
|---|---|---|---|---|
| CAS Number | 55654-69-8 | Molecular Weight | 216.23600 | |
| Density | 1.254g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-ethyl-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Exact Mass | 216.09000 |
| PSA | 61.96000 |
| LogP | 1.87760 |
| Index of Refraction | 1.631 |
| InChIKey | WHDXKEGUQIBSNS-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C(=O)c1c[nH]c2ccccc12 |
|
~%
N-ethyl-2-(1H-i... CAS#:55654-69-8 |
| Literature: Chretien, Antony; Chataigner, Isabelle; L'Helias, Nathalie; Piettre, Serge R. Journal of Organic Chemistry, 2003 , vol. 68, # 21 p. 7990 - 8002 |
|
~%
N-ethyl-2-(1H-i... CAS#:55654-69-8 |
| Literature: Chretien, Antony; Chataigner, Isabelle; L'Helias, Nathalie; Piettre, Serge R. Journal of Organic Chemistry, 2003 , vol. 68, # 21 p. 7990 - 8002 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Ethylindole-3-glyoxylamide |
| F0675-0053 |
| N-ethyl-2-indol-3-yl-2-oxo-acetamide |
| INDOLE-3-GLYOXYLAMIDE,N-ETHYL |